C12H15NO3S — CID 79803050
2-[(4-methylthiophene-3-carbonyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 79803050) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-[(4-methylthiophene-3-carbonyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(4-methylthiophene-3-carbonyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79803050 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-[(4-methylthiophene-3-carbonyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cscc1C(=O)NC1CCCC1C(=O)O |
| InChI | InChI=1S/C12H15NO3S/c1-7-5-17-6-9(7)11(14)13-10-4-2-3-8(10)12(15)16/h5-6,8,10H,2-4H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | OKZCBMYLXHHECU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |