C16H24N2O2 — CID 79805127
2-amino-N,2-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]butanamide (PubChem CID 79805127) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-amino-N,2-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]butanamide.
| Compound Name | 2-amino-N,2-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 79805127 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-amino-N,2-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]butanamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)C(C)(N)CC)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-5-11-20-14-9-7-13(8-10-14)12-18(4)15(19)16(3,17)6-2/h5,7-10H,1,6,11-12,17H2,2-4H3 |
| InChIKey | GQQDIKIKSOYINN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|