C11H11F3N2O3 — CID 79805170
3-[(2-amino-3,3,3-trifluoro-2-methylpropanoyl)amino]benzoic acid (PubChem CID 79805170) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 3-[(2-amino-3,3,3-trifluoro-2-methylpropanoyl)amino]benzoic acid.
| Compound Name | 3-[(2-amino-3,3,3-trifluoro-2-methylpropanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 79805170 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[(2-amino-3,3,3-trifluoro-2-methylpropanoyl)amino]benzoic acid |
| SMILES | CC(N)(C(=O)Nc1cccc(C(=O)O)c1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O3/c1-10(15,11(12,13)14)9(19)16-7-4-2-3-6(5-7)8(17)18/h2-5H,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | MDVJEESQWPVIFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |