About 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide
4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide (PubChem CID 79805220) has the molecular formula C11H19F3N4O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide |
| PubChem CID | 79805220 |
| Molecular Formula | C11H19F3N4O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)C(C)(N)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N4O2/c1-3-16-9(20)18-6-4-17(5-7-18)8(19)10(2,15)11(12,13)14/h3-7,15H2,1-2H3,(H,16,20) |
| InChIKey | FAQIHAPZGKKGNN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide?
The IUPAC name of 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide (CID 79805220) is 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide.
What is the SMILES notation for 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide?
The canonical SMILES for 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide is CCNC(=O)N1CCN(C(=O)C(C)(N)C(F)(F)F)CC1.
What is the InChIKey of 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide?
The InChIKey is FAQIHAPZGKKGNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N4O2/c1-3-16-9(20)18-6-4-17(5-7-18)8(19)10(2,15)11(12,13)14/h3-7,15H2,1-2H3,(H,16,20).
What are the key properties of 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide?
4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide has a molecular weight of 296.29 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-3,3,3-trifluoro-2-methylpropanoyl)-N-ethylpiperazine-1-carboxamide is sourced from PubChem (CID 79805220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).