C15H32N4O — CID 79805247
2-amino-N-[2-(dimethylamino)ethyl]-2-methyl-N-(1-methylpiperidin-4-yl)butanamide (PubChem CID 79805247) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)ethyl]-2-methyl-N-(1-methylpiperidin-4-yl)butanamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)ethyl]-2-methyl-N-(1-methylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 79805247 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)ethyl]-2-methyl-N-(1-methylpiperidin-4-yl)butanamide |
| SMILES | CCC(C)(N)C(=O)N(CCN(C)C)C1CCN(C)CC1 |
| InChI | InChI=1S/C15H32N4O/c1-6-15(2,16)14(20)19(12-11-17(3)4)13-7-9-18(5)10-8-13/h13H,6-12,16H2,1-5H3 |
| InChIKey | FYBSBGNWIMMDCU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |