C11H20F3N3O3 — CID 79805593
2-amino-3,3,3-trifluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,2-dimethylpropanamide (PubChem CID 79805593) has the molecular formula C11H20F3N3O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,2-dimethylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 79805593 |
| Molecular Formula | C11H20F3N3O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,2-dimethylpropanamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C11H20F3N3O3/c1-10(15,11(12,13)14)9(19)17(2)7-8(18)16-5-4-6-20-3/h4-7,15H2,1-3H3,(H,16,18) |
| InChIKey | SXVLONSWUPXLNP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|