C14H21FN2O2 — CID 79805740
2-amino-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethylbutanamide (PubChem CID 79805740) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-amino-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethylbutanamide.
| Compound Name | 2-amino-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 79805740 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-amino-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethylbutanamide |
| SMILES | CCC(C)(N)C(=O)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C14H21FN2O2/c1-4-14(2,16)13(18)17(3)9-10-19-12-8-6-5-7-11(12)15/h5-8H,4,9-10,16H2,1-3H3 |
| InChIKey | HUWYPKKMOJESDM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |