About 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one
2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one (PubChem CID 79805917) has the molecular formula C9H16F3N3O3S
and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one |
| PubChem CID | 79805917 |
| Molecular Formula | C9H16F3N3O3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one |
| SMILES | CC(N)(C(=O)N1CCN(S(C)(=O)=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O3S/c1-8(13,9(10,11)12)7(16)14-3-5-15(6-4-14)19(2,17)18/h3-6,13H2,1-2H3 |
| InChIKey | ZGRWLAUSSCPLQS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one?
The IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one (CID 79805917) is 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one is CC(N)(C(=O)N1CCN(S(C)(=O)=O)CC1)C(F)(F)F.
What is the InChIKey of 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one?
The InChIKey is ZGRWLAUSSCPLQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3O3S/c1-8(13,9(10,11)12)7(16)14-3-5-15(6-4-14)19(2,17)18/h3-6,13H2,1-2H3.
What are the key properties of 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one?
2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one has a molecular weight of 303.31 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3,3-trifluoro-2-methyl-1-(4-methylsulfonylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 79805917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).