About 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride
3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride (PubChem CID 79807441) has the molecular formula C10H11ClF3NO3S2
and a molecular weight of 349.78 g/mol. Its IUPAC name is 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride |
| PubChem CID | 79807441 |
| Molecular Formula | C10H11ClF3NO3S2 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride |
| SMILES | Cc1c(C(=O)N(C)CCC(F)(F)F)csc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H11ClF3NO3S2/c1-6-7(5-19-9(6)20(11,17)18)8(16)15(2)4-3-10(12,13)14/h5H,3-4H2,1-2H3 |
| InChIKey | PJSVGPPQCITQCJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride?
The IUPAC name of 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride (CID 79807441) is 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride.
What is the SMILES notation for 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride?
The canonical SMILES for 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride is Cc1c(C(=O)N(C)CCC(F)(F)F)csc1S(=O)(=O)Cl.
What is the InChIKey of 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride?
The InChIKey is PJSVGPPQCITQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF3NO3S2/c1-6-7(5-19-9(6)20(11,17)18)8(16)15(2)4-3-10(12,13)14/h5H,3-4H2,1-2H3.
What are the key properties of 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride?
3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride has a molecular weight of 349.78 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[methyl(3,3,3-trifluoropropyl)carbamoyl]thiophene-2-sulfonyl chloride is sourced from PubChem (CID 79807441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).