C14H16OS — CID 79808123
(3,4-dimethylphenyl)-(4-methylthiophen-3-yl)methanol (PubChem CID 79808123) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(4-methylthiophen-3-yl)methanol.
| Compound Name | (3,4-dimethylphenyl)-(4-methylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79808123 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3,4-dimethylphenyl)-(4-methylthiophen-3-yl)methanol |
| SMILES | Cc1ccc(C(O)c2cscc2C)cc1C |
| InChI | InChI=1S/C14H16OS/c1-9-4-5-12(6-10(9)2)14(15)13-8-16-7-11(13)3/h4-8,14-15H,1-3H3 |
| InChIKey | KJOOXGVPLXHKAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |