C12H17N3S — CID 79808147
N-[(1-methylimidazol-2-yl)-(4-methylthiophen-3-yl)methyl]ethanamine (PubChem CID 79808147) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-(4-methylthiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)-(4-methylthiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79808147 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-(4-methylthiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1cscc1C)c1nccn1C |
| InChI | InChI=1S/C12H17N3S/c1-4-13-11(10-8-16-7-9(10)2)12-14-5-6-15(12)3/h5-8,11,13H,4H2,1-3H3 |
| InChIKey | SHXDBWOFUFSQNG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |