C12H18N2OS — CID 79808514
4-methyl-N-(piperidin-4-ylmethyl)thiophene-3-carboxamide (PubChem CID 79808514) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-methyl-N-(piperidin-4-ylmethyl)thiophene-3-carboxamide.
| Compound Name | 4-methyl-N-(piperidin-4-ylmethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79808514 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-methyl-N-(piperidin-4-ylmethyl)thiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C12H18N2OS/c1-9-7-16-8-11(9)12(15)14-6-10-2-4-13-5-3-10/h7-8,10,13H,2-6H2,1H3,(H,14,15) |
| InChIKey | WYMIKQPAWAPZQT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |