C17H21BrS — CID 79808949
3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-4-methylthiophene (PubChem CID 79808949) has the molecular formula C17H21BrS and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-4-methylthiophene.
| Compound Name | 3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-4-methylthiophene |
|---|---|
| PubChem CID | 79808949 |
| Molecular Formula | C17H21BrS |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-4-methylthiophene |
| SMILES | Cc1cscc1C(Br)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C17H21BrS/c1-9-7-19-8-15(9)17(18)16-13(5)11(3)10(2)12(4)14(16)6/h7-8,17H,1-6H3 |
| InChIKey | VZYVHQDNLDJXLM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|