About 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide
2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide (PubChem CID 79809442) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide.
Molecular Properties
| Compound Name | 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide |
| PubChem CID | 79809442 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide |
| SMILES | CCC(N)(CC)C(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H28N2O/c1-3-16(17,4-2)15(19)18-14-9-10-8-13(14)12-7-5-6-11(10)12/h10-14H,3-9,17H2,1-2H3,(H,18,19) |
| InChIKey | AQBAKABWUOAWLI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The IUPAC name of 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide (CID 79809442) is 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide.
What is the SMILES notation for 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The canonical SMILES for 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide is CCC(N)(CC)C(=O)NC1CC2CC1C1CCCC21.
What is the InChIKey of 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The InChIKey is AQBAKABWUOAWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-3-16(17,4-2)15(19)18-14-9-10-8-13(14)12-7-5-6-11(10)12/h10-14H,3-9,17H2,1-2H3,(H,18,19).
What are the key properties of 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide has a molecular weight of 264.41 g/mol, XLogP of 2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-ethyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide is sourced from PubChem (CID 79809442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).