About 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide
2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide (PubChem CID 79809789) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide.
Molecular Properties
| Compound Name | 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide |
| PubChem CID | 79809789 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide |
| SMILES | CCC(N)(CC)C(=O)Nc1c(C)nn(C(C)C)c1C |
| InChI | InChI=1S/C14H26N4O/c1-7-14(15,8-2)13(19)16-12-10(5)17-18(9(3)4)11(12)6/h9H,7-8,15H2,1-6H3,(H,16,19) |
| InChIKey | DXDPEIZIGKCBBB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide?
The IUPAC name of 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide (CID 79809789) is 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide.
What is the SMILES notation for 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide?
The canonical SMILES for 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide is CCC(N)(CC)C(=O)Nc1c(C)nn(C(C)C)c1C.
What is the InChIKey of 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide?
The InChIKey is DXDPEIZIGKCBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O/c1-7-14(15,8-2)13(19)16-12-10(5)17-18(9(3)4)11(12)6/h9H,7-8,15H2,1-6H3,(H,16,19).
What are the key properties of 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide?
2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide has a molecular weight of 266.39 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2-ethylbutanamide is sourced from PubChem (CID 79809789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).