About 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide
2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide (PubChem CID 79811464) has the molecular formula C7H13F3N2OS
and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide.
Molecular Properties
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide |
| PubChem CID | 79811464 |
| Molecular Formula | C7H13F3N2OS |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide |
| SMILES | CSCCNC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N2OS/c1-6(11,7(8,9)10)5(13)12-3-4-14-2/h3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | VITACXMNNPNMCT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide?
The IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide (CID 79811464) is 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide.
What is the SMILES notation for 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide?
The canonical SMILES for 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide is CSCCNC(=O)C(C)(N)C(F)(F)F.
What is the InChIKey of 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide?
The InChIKey is VITACXMNNPNMCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2OS/c1-6(11,7(8,9)10)5(13)12-3-4-14-2/h3-4,11H2,1-2H3,(H,12,13).
What are the key properties of 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide?
2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide has a molecular weight of 230.25 g/mol, XLogP of 0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3,3-trifluoro-2-methyl-N-(2-methylsulfanylethyl)propanamide is sourced from PubChem (CID 79811464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).