C12H24N2O2 — CID 79811911
2-amino-N,2-dimethyl-N-(oxan-3-ylmethyl)butanamide (PubChem CID 79811911) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-amino-N,2-dimethyl-N-(oxan-3-ylmethyl)butanamide.
| Compound Name | 2-amino-N,2-dimethyl-N-(oxan-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 79811911 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-amino-N,2-dimethyl-N-(oxan-3-ylmethyl)butanamide |
| SMILES | CCC(C)(N)C(=O)N(C)CC1CCCOC1 |
| InChI | InChI=1S/C12H24N2O2/c1-4-12(2,13)11(15)14(3)8-10-6-5-7-16-9-10/h10H,4-9,13H2,1-3H3 |
| InChIKey | VOXSSPUMXGIDPY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |