About 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide
2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide (PubChem CID 79812031) has the molecular formula C9H17F3N2O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide |
| PubChem CID | 79812031 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide |
| SMILES | COCCC(C)NC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-6(4-5-16-3)14-7(15)8(2,13)9(10,11)12/h6H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | OFLCQBUDYWPTFW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide?
The IUPAC name of 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide (CID 79812031) is 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide.
What is the SMILES notation for 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide?
The canonical SMILES for 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide is COCCC(C)NC(=O)C(C)(N)C(F)(F)F.
What is the InChIKey of 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide?
The InChIKey is OFLCQBUDYWPTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2/c1-6(4-5-16-3)14-7(15)8(2,13)9(10,11)12/h6H,4-5,13H2,1-3H3,(H,14,15).
What are the key properties of 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide?
2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide has a molecular weight of 242.24 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3,3-trifluoro-N-(4-methoxybutan-2-yl)-2-methylpropanamide is sourced from PubChem (CID 79812031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).