About 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide
2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide (PubChem CID 79812234) has the molecular formula C10H17F3N2O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide |
| PubChem CID | 79812234 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide |
| SMILES | CC(N)(C(=O)NCC1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2/c1-9(14,10(11,12)13)8(16)15-6-7-2-4-17-5-3-7/h7H,2-6,14H2,1H3,(H,15,16) |
| InChIKey | BDTJAZUJVPRIQH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide?
The IUPAC name of 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide (CID 79812234) is 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide.
What is the SMILES notation for 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide?
The canonical SMILES for 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide is CC(N)(C(=O)NCC1CCOCC1)C(F)(F)F.
What is the InChIKey of 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide?
The InChIKey is BDTJAZUJVPRIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2/c1-9(14,10(11,12)13)8(16)15-6-7-2-4-17-5-3-7/h7H,2-6,14H2,1H3,(H,15,16).
What are the key properties of 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide?
2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide has a molecular weight of 254.25 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3,3-trifluoro-2-methyl-N-(oxan-4-ylmethyl)propanamide is sourced from PubChem (CID 79812234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).