About 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine
2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79815922) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 79815922 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CN(C)c1ccc2[nH]c(Cc3ccccc3)nc2n1 |
| InChI | InChI=1S/C15H16N4/c1-19(2)14-9-8-12-15(18-14)17-13(16-12)10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,16,17,18) |
| InChIKey | RYDPFPXIIGZBTG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine (CID 79815922) is 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine is CN(C)c1ccc2[nH]c(Cc3ccccc3)nc2n1.
What is the InChIKey of 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is RYDPFPXIIGZBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4/c1-19(2)14-9-8-12-15(18-14)17-13(16-12)10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,16,17,18).
What are the key properties of 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine?
2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 252.32 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 79815922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).