C15H24N4O — CID 79816332
6-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)heptan-2-amine (PubChem CID 79816332) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)heptan-2-amine.
| Compound Name | 6-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)heptan-2-amine |
|---|---|
| PubChem CID | 79816332 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 6-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)heptan-2-amine |
| SMILES | CCOc1ccc2[nH]c(C(C)CCCC(C)N)nc2n1 |
| InChI | InChI=1S/C15H24N4O/c1-4-20-13-9-8-12-15(18-13)19-14(17-12)10(2)6-5-7-11(3)16/h8-11H,4-7,16H2,1-3H3,(H,17,18,19) |
| InChIKey | CPMXCUDQHRCKFQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |