About 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine
4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (PubChem CID 79816479) has the molecular formula C13H13N5O
and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| PubChem CID | 79816479 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| SMILES | CCOc1ccc2[nH]c(-c3ccnc(N)c3)nc2n1 |
| InChI | InChI=1S/C13H13N5O/c1-2-19-11-4-3-9-13(17-11)18-12(16-9)8-5-6-15-10(14)7-8/h3-7H,2H2,1H3,(H2,14,15)(H,16,17,18) |
| InChIKey | YZMXTFOOIUDCIE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The IUPAC name of 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (CID 79816479) is 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
What is the SMILES notation for 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The canonical SMILES for 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is CCOc1ccc2[nH]c(-c3ccnc(N)c3)nc2n1.
What is the InChIKey of 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The InChIKey is YZMXTFOOIUDCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O/c1-2-19-11-4-3-9-13(17-11)18-12(16-9)8-5-6-15-10(14)7-8/h3-7H,2H2,1H3,(H2,14,15)(H,16,17,18).
What are the key properties of 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine has a molecular weight of 255.28 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is sourced from PubChem (CID 79816479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).