C17H19N3O — CID 79816768
5-ethoxy-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 79816768) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-ethoxy-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-ethoxy-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79816768 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-ethoxy-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CCOc1ccc2[nH]c(-c3c(C)cc(C)cc3C)nc2n1 |
| InChI | InChI=1S/C17H19N3O/c1-5-21-14-7-6-13-16(19-14)20-17(18-13)15-11(3)8-10(2)9-12(15)4/h6-9H,5H2,1-4H3,(H,18,19,20) |
| InChIKey | GAMFFCADTZHPHR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |