About 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine
6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine (PubChem CID 79817008) has the molecular formula C13H18N4S
and a molecular weight of 262.38 g/mol. Its IUPAC name is 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine |
| PubChem CID | 79817008 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(Cc2nc(C(C)(C)C)cs2)ncn1 |
| InChI | InChI=1S/C13H18N4S/c1-13(2,3)10-7-18-12(17-10)6-9-5-11(14-4)16-8-15-9/h5,7-8H,6H2,1-4H3,(H,14,15,16) |
| InChIKey | KVTRXVSXKAPKOH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine?
The IUPAC name of 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine (CID 79817008) is 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine.
What is the SMILES notation for 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine?
The canonical SMILES for 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine is CNc1cc(Cc2nc(C(C)(C)C)cs2)ncn1.
What is the InChIKey of 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine?
The InChIKey is KVTRXVSXKAPKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4S/c1-13(2,3)10-7-18-12(17-10)6-9-5-11(14-4)16-8-15-9/h5,7-8H,6H2,1-4H3,(H,14,15,16).
What are the key properties of 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine?
6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine has a molecular weight of 262.38 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-methylpyrimidin-4-amine is sourced from PubChem (CID 79817008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).