C14H20ClN3O3 — CID 79817560
3-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrobenzamide (PubChem CID 79817560) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is 3-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrobenzamide.
| Compound Name | 3-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 79817560 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrobenzamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20ClN3O3/c1-14(2,9-17(3)4)8-16-13(19)10-6-5-7-11(15)12(10)18(20)21/h5-7H,8-9H2,1-4H3,(H,16,19) |
| InChIKey | ZFFLPEUAEUVHTE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|