C13H11F2N5 — CID 79817684
2-(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4,5-difluoroaniline (PubChem CID 79817684) has the molecular formula C13H11F2N5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4,5-difluoroaniline.
| Compound Name | 2-(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4,5-difluoroaniline |
|---|---|
| PubChem CID | 79817684 |
| Molecular Formula | C13H11F2N5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4,5-difluoroaniline |
| SMILES | Cc1cc2nnc(-c3cc(F)c(F)cc3N)n2c(C)n1 |
| InChI | InChI=1S/C13H11F2N5/c1-6-3-12-18-19-13(20(12)7(2)17-6)8-4-9(14)10(15)5-11(8)16/h3-5H,16H2,1-2H3 |
| InChIKey | UTIIJRKYRQYMOI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|