C15H20N2S — CID 79817942
5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methylaniline (PubChem CID 79817942) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methylaniline.
| Compound Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 79817942 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methylaniline |
| SMILES | Cc1ccc(Cc2nc(C(C)(C)C)cs2)cc1N |
| InChI | InChI=1S/C15H20N2S/c1-10-5-6-11(7-12(10)16)8-14-17-13(9-18-14)15(2,3)4/h5-7,9H,8,16H2,1-4H3 |
| InChIKey | CHWJBBLGPHQYIF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|