About 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde
4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde (PubChem CID 79820062) has the molecular formula C9H6ClN3OS
and a molecular weight of 239.69 g/mol. Its IUPAC name is 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde |
| PubChem CID | 79820062 |
| Molecular Formula | C9H6ClN3OS |
| Molecular Weight | 239.69 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(Cl)ncnc1Cc1nccs1 |
| InChI | InChI=1S/C9H6ClN3OS/c10-9-6(4-14)7(12-5-13-9)3-8-11-1-2-15-8/h1-2,4-5H,3H2 |
| InChIKey | CVIOMAVHJFVVCN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde?
The IUPAC name of 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde (CID 79820062) is 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde?
The canonical SMILES for 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde is O=Cc1c(Cl)ncnc1Cc1nccs1.
What is the InChIKey of 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde?
The InChIKey is CVIOMAVHJFVVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN3OS/c10-9-6(4-14)7(12-5-13-9)3-8-11-1-2-15-8/h1-2,4-5H,3H2.
What are the key properties of 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde?
4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde has a molecular weight of 239.69 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidine-5-carbaldehyde is sourced from PubChem (CID 79820062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).