About 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine
2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821394) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 79821394 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | COCCc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C9H12N4O/c1-14-5-4-8-11-6-2-3-7(10)12-9(6)13-8/h2-3H,4-5H2,1H3,(H3,10,11,12,13) |
| InChIKey | KBNYMYJQHGMZCT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine (CID 79821394) is 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine is COCCc1nc2nc(N)ccc2[nH]1.
What is the InChIKey of 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is KBNYMYJQHGMZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-14-5-4-8-11-6-2-3-7(10)12-9(6)13-8/h2-3H,4-5H2,1H3,(H3,10,11,12,13).
What are the key properties of 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 192.22 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 79821394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).