About 6-N-butan-2-ylpyridine-2,3,6-triamine
6-N-butan-2-ylpyridine-2,3,6-triamine (PubChem CID 79822121) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-N-butan-2-ylpyridine-2,3,6-triamine.
Molecular Properties
| Compound Name | 6-N-butan-2-ylpyridine-2,3,6-triamine |
| PubChem CID | 79822121 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 6-N-butan-2-ylpyridine-2,3,6-triamine |
| SMILES | CCC(C)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C9H16N4/c1-3-6(2)12-8-5-4-7(10)9(11)13-8/h4-6H,3,10H2,1-2H3,(H3,11,12,13) |
| InChIKey | IIUBORNMLAIWKL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-N-butan-2-ylpyridine-2,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-butan-2-ylpyridine-2,3,6-triamine?
The IUPAC name of 6-N-butan-2-ylpyridine-2,3,6-triamine (CID 79822121) is 6-N-butan-2-ylpyridine-2,3,6-triamine.
What is the SMILES notation for 6-N-butan-2-ylpyridine-2,3,6-triamine?
The canonical SMILES for 6-N-butan-2-ylpyridine-2,3,6-triamine is CCC(C)Nc1ccc(N)c(N)n1.
What is the InChIKey of 6-N-butan-2-ylpyridine-2,3,6-triamine?
The InChIKey is IIUBORNMLAIWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-3-6(2)12-8-5-4-7(10)9(11)13-8/h4-6H,3,10H2,1-2H3,(H3,11,12,13).
What are the key properties of 6-N-butan-2-ylpyridine-2,3,6-triamine?
6-N-butan-2-ylpyridine-2,3,6-triamine has a molecular weight of 180.25 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-butan-2-ylpyridine-2,3,6-triamine is sourced from PubChem (CID 79822121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).