About 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol
4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol (PubChem CID 79822536) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol |
| PubChem CID | 79822536 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol |
| SMILES | Nc1ccc(NC2CCC(O)CC2)nc1N |
| InChI | InChI=1S/C11H18N4O/c12-9-5-6-10(15-11(9)13)14-7-1-3-8(16)4-2-7/h5-8,16H,1-4,12H2,(H3,13,14,15) |
| InChIKey | YRRUKOIGIWWFRG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol?
The IUPAC name of 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol (CID 79822536) is 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol?
The canonical SMILES for 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol is Nc1ccc(NC2CCC(O)CC2)nc1N.
What is the InChIKey of 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol?
The InChIKey is YRRUKOIGIWWFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O/c12-9-5-6-10(15-11(9)13)14-7-1-3-8(16)4-2-7/h5-8,16H,1-4,12H2,(H3,13,14,15).
What are the key properties of 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol?
4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol has a molecular weight of 222.29 g/mol, XLogP of 0.96, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol is sourced from PubChem (CID 79822536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).