About 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine
4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine (PubChem CID 79823008) has the molecular formula C12H14Cl2N4
and a molecular weight of 285.18 g/mol. Its IUPAC name is 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine |
| PubChem CID | 79823008 |
| Molecular Formula | C12H14Cl2N4 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine |
| SMILES | CCc1nn(-c2cc(C)nc(C)n2)c(Cl)c1CCl |
| InChI | InChI=1S/C12H14Cl2N4/c1-4-10-9(6-13)12(14)18(17-10)11-5-7(2)15-8(3)16-11/h5H,4,6H2,1-3H3 |
| InChIKey | WVZNURRZLXRKRA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine?
The IUPAC name of 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine (CID 79823008) is 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine.
What is the SMILES notation for 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine?
The canonical SMILES for 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine is CCc1nn(-c2cc(C)nc(C)n2)c(Cl)c1CCl.
What is the InChIKey of 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine?
The InChIKey is WVZNURRZLXRKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N4/c1-4-10-9(6-13)12(14)18(17-10)11-5-7(2)15-8(3)16-11/h5H,4,6H2,1-3H3.
What are the key properties of 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine?
4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine has a molecular weight of 285.18 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-4-(chloromethyl)-3-ethylpyrazol-1-yl]-2,6-dimethylpyrimidine is sourced from PubChem (CID 79823008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).