About [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol
[5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol (PubChem CID 79823360) has the molecular formula C11H10ClF3N4O
and a molecular weight of 306.68 g/mol. Its IUPAC name is [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol |
| PubChem CID | 79823360 |
| Molecular Formula | C11H10ClF3N4O |
| Molecular Weight | 306.68 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol |
| SMILES | Cc1cc(-n2nc(C(F)(F)F)c(CO)c2Cl)nc(C)n1 |
| InChI | InChI=1S/C11H10ClF3N4O/c1-5-3-8(17-6(2)16-5)19-10(12)7(4-20)9(18-19)11(13,14)15/h3,20H,4H2,1-2H3 |
| InChIKey | STDSRJPUWMWKMC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol?
The IUPAC name of [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol (CID 79823360) is [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol.
What is the SMILES notation for [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol?
The canonical SMILES for [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol is Cc1cc(-n2nc(C(F)(F)F)c(CO)c2Cl)nc(C)n1.
What is the InChIKey of [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol?
The InChIKey is STDSRJPUWMWKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF3N4O/c1-5-3-8(17-6(2)16-5)19-10(12)7(4-20)9(18-19)11(13,14)15/h3,20H,4H2,1-2H3.
What are the key properties of [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol?
[5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol has a molecular weight of 306.68 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-(trifluoromethyl)pyrazol-4-yl]methanol is sourced from PubChem (CID 79823360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).