About 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol
4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol (PubChem CID 79823680) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol |
| PubChem CID | 79823680 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol |
| SMILES | COCCC(O)Cc1nccs1 |
| InChI | InChI=1S/C8H13NO2S/c1-11-4-2-7(10)6-8-9-3-5-12-8/h3,5,7,10H,2,4,6H2,1H3 |
| InChIKey | ARFABIGLTXAQAP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol?
The IUPAC name of 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol (CID 79823680) is 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol.
What is the SMILES notation for 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol?
The canonical SMILES for 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol is COCCC(O)Cc1nccs1.
What is the InChIKey of 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol?
The InChIKey is ARFABIGLTXAQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-11-4-2-7(10)6-8-9-3-5-12-8/h3,5,7,10H,2,4,6H2,1H3.
What are the key properties of 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol?
4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol has a molecular weight of 187.26 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-(1,3-thiazol-2-yl)butan-2-ol is sourced from PubChem (CID 79823680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).