About 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine
5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine (PubChem CID 79823747) has the molecular formula C9H8ClN3S
and a molecular weight of 225.70 g/mol. Its IUPAC name is 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine |
| PubChem CID | 79823747 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine |
| SMILES | Nc1ncc(Cl)cc1Cc1nccs1 |
| InChI | InChI=1S/C9H8ClN3S/c10-7-3-6(9(11)13-5-7)4-8-12-1-2-14-8/h1-3,5H,4H2,(H2,11,13) |
| InChIKey | OSBPMWNYVSTFMR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine?
The IUPAC name of 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine (CID 79823747) is 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine.
What is the SMILES notation for 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine?
The canonical SMILES for 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine is Nc1ncc(Cl)cc1Cc1nccs1.
What is the InChIKey of 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine?
The InChIKey is OSBPMWNYVSTFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3S/c10-7-3-6(9(11)13-5-7)4-8-12-1-2-14-8/h1-3,5H,4H2,(H2,11,13).
What are the key properties of 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine?
5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine has a molecular weight of 225.70 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(1,3-thiazol-2-ylmethyl)pyridin-2-amine is sourced from PubChem (CID 79823747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).