About (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone
(5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone (PubChem CID 798239) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone |
| PubChem CID | 798239 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1cc2ncn(C(=O)c3c(-c4ccccc4)noc3C)c2cc1C |
| InChI | InChI=1S/C20H17N3O2/c1-12-9-16-17(10-13(12)2)23(11-21-16)20(24)18-14(3)25-22-19(18)15-7-5-4-6-8-15/h4-11H,1-3H3 |
| InChIKey | YBVBVVFVNKLFOQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone?
The IUPAC name of (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone (CID 798239) is (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone is Cc1cc2ncn(C(=O)c3c(-c4ccccc4)noc3C)c2cc1C.
What is the InChIKey of (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone?
The InChIKey is YBVBVVFVNKLFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c1-12-9-16-17(10-13(12)2)23(11-21-16)20(24)18-14(3)25-22-19(18)15-7-5-4-6-8-15/h4-11H,1-3H3.
What are the key properties of (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone?
(5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone has a molecular weight of 331.38 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dimethylbenzimidazol-1-yl)-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 798239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).