About 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine
1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine (PubChem CID 79824023) has the molecular formula C12H13ClN2S
and a molecular weight of 252.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine |
| PubChem CID | 79824023 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine |
| SMILES | NC(Cc1cccc(Cl)c1)Cc1nccs1 |
| InChI | InChI=1S/C12H13ClN2S/c13-10-3-1-2-9(6-10)7-11(14)8-12-15-4-5-16-12/h1-6,11H,7-8,14H2 |
| InChIKey | SVQCNUNXUAFZOU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine?
The IUPAC name of 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine (CID 79824023) is 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine.
What is the SMILES notation for 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine?
The canonical SMILES for 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine is NC(Cc1cccc(Cl)c1)Cc1nccs1.
What is the InChIKey of 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine?
The InChIKey is SVQCNUNXUAFZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2S/c13-10-3-1-2-9(6-10)7-11(14)8-12-15-4-5-16-12/h1-6,11H,7-8,14H2.
What are the key properties of 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine?
1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine has a molecular weight of 252.77 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-3-(1,3-thiazol-2-yl)propan-2-amine is sourced from PubChem (CID 79824023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).