C13H17N3S — CID 79824684
N-[1-pyridin-4-yl-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine (PubChem CID 79824684) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-[1-pyridin-4-yl-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-pyridin-4-yl-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79824684 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[1-pyridin-4-yl-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1nccs1)c1ccncc1 |
| InChI | InChI=1S/C13H17N3S/c1-2-5-15-12(10-13-16-8-9-17-13)11-3-6-14-7-4-11/h3-4,6-9,12,15H,2,5,10H2,1H3 |
| InChIKey | VNAAPKSAJDXKFJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |