About N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine
N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 79824744) has the molecular formula C13H22N2S
and a molecular weight of 238.40 g/mol. Its IUPAC name is N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
| PubChem CID | 79824744 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CCCNC1CCCC(Cc2nccs2)C1 |
| InChI | InChI=1S/C13H22N2S/c1-2-6-14-12-5-3-4-11(9-12)10-13-15-7-8-16-13/h7-8,11-12,14H,2-6,9-10H2,1H3 |
| InChIKey | RGBVRHZOCQJKDC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine?
The IUPAC name of N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine (CID 79824744) is N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine.
What is the SMILES notation for N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine?
The canonical SMILES for N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine is CCCNC1CCCC(Cc2nccs2)C1.
What is the InChIKey of N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine?
The InChIKey is RGBVRHZOCQJKDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2S/c1-2-6-14-12-5-3-4-11(9-12)10-13-15-7-8-16-13/h7-8,11-12,14H,2-6,9-10H2,1H3.
What are the key properties of N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine?
N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine has a molecular weight of 238.40 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine is sourced from PubChem (CID 79824744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).