About N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine
N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine (PubChem CID 79824844) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine |
| PubChem CID | 79824844 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine |
| SMILES | CNCc1cccc(Cc2nccs2)c1 |
| InChI | InChI=1S/C12H14N2S/c1-13-9-11-4-2-3-10(7-11)8-12-14-5-6-15-12/h2-7,13H,8-9H2,1H3 |
| InChIKey | BEBFNLIEMBVMSE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine?
The IUPAC name of N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine (CID 79824844) is N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine.
What is the SMILES notation for N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine?
The canonical SMILES for N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine is CNCc1cccc(Cc2nccs2)c1.
What is the InChIKey of N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine?
The InChIKey is BEBFNLIEMBVMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-13-9-11-4-2-3-10(7-11)8-12-14-5-6-15-12/h2-7,13H,8-9H2,1H3.
What are the key properties of N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine?
N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine has a molecular weight of 218.33 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[3-(1,3-thiazol-2-ylmethyl)phenyl]methanamine is sourced from PubChem (CID 79824844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).