C10H15F3N4 — CID 79825411
6-N-propyl-6-N-(2,2,2-trifluoroethyl)pyridine-2,3,6-triamine (PubChem CID 79825411) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is 6-N-propyl-6-N-(2,2,2-trifluoroethyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-propyl-6-N-(2,2,2-trifluoroethyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79825411 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-N-propyl-6-N-(2,2,2-trifluoroethyl)pyridine-2,3,6-triamine |
| SMILES | CCCN(CC(F)(F)F)c1ccc(N)c(N)n1 |
| InChI | InChI=1S/C10H15F3N4/c1-2-5-17(6-10(11,12)13)8-4-3-7(14)9(15)16-8/h3-4H,2,5-6,14H2,1H3,(H2,15,16) |
| InChIKey | GAKQEWXQFUZGEX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |