C10H12ClN5 — CID 79825439
6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridine-2,3-diamine (PubChem CID 79825439) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridine-2,3-diamine.
| Compound Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79825439 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridine-2,3-diamine |
| SMILES | Cc1nn(-c2ccc(N)c(N)n2)c(C)c1Cl |
| InChI | InChI=1S/C10H12ClN5/c1-5-9(11)6(2)16(15-5)8-4-3-7(12)10(13)14-8/h3-4H,12H2,1-2H3,(H2,13,14) |
| InChIKey | MNGQRULICMEJHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |