C9H9F3N4O4 — CID 79825458
2-[(6-amino-5-nitro-2-pyridinyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79825458) has the molecular formula C9H9F3N4O4 and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-[(6-amino-5-nitro-2-pyridinyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(6-amino-5-nitro-2-pyridinyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79825458 |
| Molecular Formula | C9H9F3N4O4 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(6-amino-5-nitro-2-pyridinyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CC(Nc1ccc([N+](=O)[O-])c(N)n1)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N4O4/c1-8(7(17)18,9(10,11)12)15-5-3-2-4(16(19)20)6(13)14-5/h2-3H,1H3,(H,17,18)(H3,13,14,15) |
| InChIKey | WRZNYIYGFOLWLF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|