About N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide
N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide (PubChem CID 79825462) has the molecular formula C13H14N4OS
and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide |
| PubChem CID | 79825462 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2ccc(N)c(N)n2)cc1 |
| InChI | InChI=1S/C13H14N4OS/c1-8(18)16-9-2-4-10(5-3-9)19-12-7-6-11(14)13(15)17-12/h2-7H,14H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | XWFFZVJULQNOJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide?
The IUPAC name of N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide (CID 79825462) is N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide is CC(=O)Nc1ccc(Sc2ccc(N)c(N)n2)cc1.
What is the InChIKey of N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide?
The InChIKey is XWFFZVJULQNOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4OS/c1-8(18)16-9-2-4-10(5-3-9)19-12-7-6-11(14)13(15)17-12/h2-7H,14H2,1H3,(H2,15,17)(H,16,18).
What are the key properties of N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide?
N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide has a molecular weight of 274.35 g/mol, XLogP of 2.36, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5,6-diamino-2-pyridinyl)sulfanyl]phenyl]acetamide is sourced from PubChem (CID 79825462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).