C14H22N6S — CID 79826586
6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 79826586) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 79826586 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cc2nc(C(C)(C)C)cs2)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H22N6S/c1-14(2,3)9-8-21-11(16-9)7-10-17-12(15-4)19-13(18-10)20(5)6/h8H,7H2,1-6H3,(H,15,17,18,19) |
| InChIKey | XUZFOTSKUWDGFK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |