About 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid
4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 798266) has the molecular formula C15H14N2O6
and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid |
| PubChem CID | 798266 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)CC1 |
| InChI | InChI=1S/C15H14N2O6/c18-13-10-2-1-3-11(17(22)23)12(10)14(19)16(13)9-6-4-8(5-7-9)15(20)21/h1-3,8-9H,4-7H2,(H,20,21) |
| InChIKey | OYSVLSUFXVYDTO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid (CID 798266) is 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid is O=C(O)C1CCC(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)CC1.
What is the InChIKey of 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid?
The InChIKey is OYSVLSUFXVYDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O6/c18-13-10-2-1-3-11(17(22)23)12(10)14(19)16(13)9-6-4-8(5-7-9)15(20)21/h1-3,8-9H,4-7H2,(H,20,21).
What are the key properties of 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid?
4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid has a molecular weight of 318.29 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 798266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).