About 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine
6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine (PubChem CID 79826659) has the molecular formula C12H21N5
and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine.
Molecular Properties
| Compound Name | 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine |
| PubChem CID | 79826659 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine |
| SMILES | CN(CCN1CCCC1)c1ccc(N)c(N)n1 |
| InChI | InChI=1S/C12H21N5/c1-16(8-9-17-6-2-3-7-17)11-5-4-10(13)12(14)15-11/h4-5H,2-3,6-9,13H2,1H3,(H2,14,15) |
| InChIKey | WNMSNHGRDPHXSE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine?
The IUPAC name of 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine (CID 79826659) is 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine.
What is the SMILES notation for 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine?
The canonical SMILES for 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine is CN(CCN1CCCC1)c1ccc(N)c(N)n1.
What is the InChIKey of 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine?
The InChIKey is WNMSNHGRDPHXSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5/c1-16(8-9-17-6-2-3-7-17)11-5-4-10(13)12(14)15-11/h4-5H,2-3,6-9,13H2,1H3,(H2,14,15).
What are the key properties of 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine?
6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine has a molecular weight of 235.33 g/mol, XLogP of 0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-methyl-6-N-(2-pyrrolidin-1-ylethyl)pyridine-2,3,6-triamine is sourced from PubChem (CID 79826659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).