About 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide
1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 79827052) has the molecular formula C11H14N6O
and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide |
| PubChem CID | 79827052 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2ccc(N)c(N)n2)n1 |
| InChI | InChI=1S/C11H14N6O/c1-16(2)11(18)8-5-6-17(15-8)9-4-3-7(12)10(13)14-9/h3-6H,12H2,1-2H3,(H2,13,14) |
| InChIKey | LPPCHBDHWIPFJF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide?
The IUPAC name of 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide (CID 79827052) is 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide?
The canonical SMILES for 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide is CN(C)C(=O)c1ccn(-c2ccc(N)c(N)n2)n1.
What is the InChIKey of 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide?
The InChIKey is LPPCHBDHWIPFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6O/c1-16(2)11(18)8-5-6-17(15-8)9-4-3-7(12)10(13)14-9/h3-6H,12H2,1-2H3,(H2,13,14).
What are the key properties of 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide?
1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide has a molecular weight of 246.27 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-diamino-2-pyridinyl)-N,N-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 79827052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).