About 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide
1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide (PubChem CID 79827053) has the molecular formula C9H10N6O
and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide |
| PubChem CID | 79827053 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(-c2ccc(N)c(N)n2)c1 |
| InChI | InChI=1S/C9H10N6O/c10-6-1-2-7(14-8(6)11)15-4-5(3-13-15)9(12)16/h1-4H,10H2,(H2,11,14)(H2,12,16) |
| InChIKey | IQSQSRYEVHIGEU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide?
The IUPAC name of 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide (CID 79827053) is 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide?
The canonical SMILES for 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide is NC(=O)c1cnn(-c2ccc(N)c(N)n2)c1.
What is the InChIKey of 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide?
The InChIKey is IQSQSRYEVHIGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6O/c10-6-1-2-7(14-8(6)11)15-4-5(3-13-15)9(12)16/h1-4H,10H2,(H2,11,14)(H2,12,16).
What are the key properties of 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide?
1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide has a molecular weight of 218.22 g/mol, XLogP of -0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-diamino-2-pyridinyl)pyrazole-4-carboxamide is sourced from PubChem (CID 79827053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).