About 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile
5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 79829755) has the molecular formula C11H10N4S
and a molecular weight of 230.30 g/mol. Its IUPAC name is 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile |
| PubChem CID | 79829755 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCCc2cscn2)cn1 |
| InChI | InChI=1S/C11H10N4S/c12-5-9-1-2-10(6-14-9)13-4-3-11-7-16-8-15-11/h1-2,6-8,13H,3-4H2 |
| InChIKey | LMTTWMLAPJODOC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile?
The IUPAC name of 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile (CID 79829755) is 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile?
The canonical SMILES for 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile is N#Cc1ccc(NCCc2cscn2)cn1.
What is the InChIKey of 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile?
The InChIKey is LMTTWMLAPJODOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4S/c12-5-9-1-2-10(6-14-9)13-4-3-11-7-16-8-15-11/h1-2,6-8,13H,3-4H2.
What are the key properties of 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile?
5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile has a molecular weight of 230.30 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-2-carbonitrile is sourced from PubChem (CID 79829755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).